C14H18F2N2O — CID 64928823
N-[(2-aminocyclohexyl)methyl]-3,4-difluorobenzamide (PubChem CID 64928823) has the molecular formula C14H18F2N2O and a molecular weight of 268.31 g/mol. Its IUPAC name is N-[(2-aminocyclohexyl)methyl]-3,4-difluorobenzamide.
| Compound Name | N-[(2-aminocyclohexyl)methyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 64928823 |
| Molecular Formula | C14H18F2N2O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-[(2-aminocyclohexyl)methyl]-3,4-difluorobenzamide |
| SMILES | NC1CCCCC1CNC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H18F2N2O/c15-11-6-5-9(7-12(11)16)14(19)18-8-10-3-1-2-4-13(10)17/h5-7,10,13H,1-4,8,17H2,(H,18,19) |
| InChIKey | NXTVKJXDHOACLK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |