C11H15N3O5S2 — CID 62157480
N-methyl-2-nitro-4-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]aniline (PubChem CID 62157480) has the molecular formula C11H15N3O5S2 and a molecular weight of 333.39 g/mol. Its IUPAC name is N-methyl-2-nitro-4-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]aniline.
| Compound Name | N-methyl-2-nitro-4-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]aniline |
|---|---|
| PubChem CID | 62157480 |
| Molecular Formula | C11H15N3O5S2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | N-methyl-2-nitro-4-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]aniline |
| SMILES | CNc1ccc(S(=O)(=O)N2CCS(=O)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N3O5S2/c1-12-10-3-2-9(8-11(10)14(15)16)21(18,19)13-4-6-20(17)7-5-13/h2-3,8,12H,4-7H2,1H3 |
| InChIKey | FSLMJZRYUPJRPE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|