C18H17ClN4O6S — CID 46663670
4-chloro-2-nitro-N'-(4-pyrrolidin-1-ylsulfonylbenzoyl)benzohydrazide (PubChem CID 46663670) has the molecular formula C18H17ClN4O6S and a molecular weight of 452.88 g/mol. Its IUPAC name is 4-chloro-2-nitro-N'-(4-pyrrolidin-1-ylsulfonylbenzoyl)benzohydrazide.
| Compound Name | 4-chloro-2-nitro-N'-(4-pyrrolidin-1-ylsulfonylbenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 46663670 |
| Molecular Formula | C18H17ClN4O6S |
| Molecular Weight | 452.88 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 4-chloro-2-nitro-N'-(4-pyrrolidin-1-ylsulfonylbenzoyl)benzohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(Cl)cc1[N+](=O)[O-])c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C18H17ClN4O6S/c19-13-5-8-15(16(11-13)23(26)27)18(25)21-20-17(24)12-3-6-14(7-4-12)30(28,29)22-9-1-2-10-22/h3-8,11H,1-2,9-10H2,(H,20,24)(H,21,25) |
| InChIKey | DZOFABQQSLDDMG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.88 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|