C17H18N4O5 — CID 9157370
4-(methylamino)-N'-[2-(2-methylphenoxy)acetyl]-3-nitrobenzohydrazide (PubChem CID 9157370) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is 4-(methylamino)-N'-[2-(2-methylphenoxy)acetyl]-3-nitrobenzohydrazide.
| Compound Name | 4-(methylamino)-N'-[2-(2-methylphenoxy)acetyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 9157370 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 4-(methylamino)-N'-[2-(2-methylphenoxy)acetyl]-3-nitrobenzohydrazide |
| SMILES | CNc1ccc(C(=O)NNC(=O)COc2ccccc2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N4O5/c1-11-5-3-4-6-15(11)26-10-16(22)19-20-17(23)12-7-8-13(18-2)14(9-12)21(24)25/h3-9,18H,10H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | ANAJSQKAXCLVNO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|