C16H15N3O7S — CID 26887625
4-methylsulfonyl-N'-[2-(2-nitrophenoxy)acetyl]benzohydrazide (PubChem CID 26887625) has the molecular formula C16H15N3O7S and a molecular weight of 393.38 g/mol. Its IUPAC name is 4-methylsulfonyl-N'-[2-(2-nitrophenoxy)acetyl]benzohydrazide.
| Compound Name | 4-methylsulfonyl-N'-[2-(2-nitrophenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 26887625 |
| Molecular Formula | C16H15N3O7S |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 4-methylsulfonyl-N'-[2-(2-nitrophenoxy)acetyl]benzohydrazide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NNC(=O)COc2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H15N3O7S/c1-27(24,25)12-8-6-11(7-9-12)16(21)18-17-15(20)10-26-14-5-3-2-4-13(14)19(22)23/h2-9H,10H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | VTXDQFNENBAJEZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|