C22H18BrN3O5 — CID 3091554
4-bromo-N-[3-[[2-(2-methylphenoxy)acetyl]amino]phenyl]-3-nitrobenzamide (PubChem CID 3091554) has the molecular formula C22H18BrN3O5 and a molecular weight of 484.31 g/mol. Its IUPAC name is 4-bromo-N-[3-[[2-(2-methylphenoxy)acetyl]amino]phenyl]-3-nitrobenzamide.
| Compound Name | 4-bromo-N-[3-[[2-(2-methylphenoxy)acetyl]amino]phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 3091554 |
| Molecular Formula | C22H18BrN3O5 |
| Molecular Weight | 484.31 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | 4-bromo-N-[3-[[2-(2-methylphenoxy)acetyl]amino]phenyl]-3-nitrobenzamide |
| SMILES | Cc1ccccc1OCC(=O)Nc1cccc(NC(=O)c2ccc(Br)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C22H18BrN3O5/c1-14-5-2-3-8-20(14)31-13-21(27)24-16-6-4-7-17(12-16)25-22(28)15-9-10-18(23)19(11-15)26(29)30/h2-12H,13H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | GWPBYDPNMWYYGH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|