C17H17BrN2O4 — CID 78805092
4-bromo-N'-[2-(2,5-dimethoxyphenyl)acetyl]benzohydrazide (PubChem CID 78805092) has the molecular formula C17H17BrN2O4 and a molecular weight of 393.24 g/mol. Its IUPAC name is 4-bromo-N'-[2-(2,5-dimethoxyphenyl)acetyl]benzohydrazide.
| Compound Name | 4-bromo-N'-[2-(2,5-dimethoxyphenyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 78805092 |
| Molecular Formula | C17H17BrN2O4 |
| Molecular Weight | 393.24 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 4-bromo-N'-[2-(2,5-dimethoxyphenyl)acetyl]benzohydrazide |
| SMILES | COc1ccc(OC)c(CC(=O)NNC(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C17H17BrN2O4/c1-23-14-7-8-15(24-2)12(9-14)10-16(21)19-20-17(22)11-3-5-13(18)6-4-11/h3-9H,10H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | RVJNBODXGYKNBJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|