C13H11BrFNO2 — CID 65431807
N-(4-bromo-3-fluorophenyl)-2,5-dimethylfuran-3-carboxamide (PubChem CID 65431807) has the molecular formula C13H11BrFNO2 and a molecular weight of 312.14 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-(4-bromo-3-fluorophenyl)-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 65431807 |
| Molecular Formula | C13H11BrFNO2 |
| Molecular Weight | 312.14 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(Br)c(F)c2)c(C)o1 |
| InChI | InChI=1S/C13H11BrFNO2/c1-7-5-10(8(2)18-7)13(17)16-9-3-4-11(14)12(15)6-9/h3-6H,1-2H3,(H,16,17) |
| InChIKey | LUEIYMREEFPCKR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.14 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |