C14H12N2O2S — CID 16648737
[4-[(2,5-dimethylfuran-3-carbonyl)amino]phenyl] thiocyanate (PubChem CID 16648737) has the molecular formula C14H12N2O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is [4-[(2,5-dimethylfuran-3-carbonyl)amino]phenyl] thiocyanate.
| Compound Name | [4-[(2,5-dimethylfuran-3-carbonyl)amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 16648737 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | [4-[(2,5-dimethylfuran-3-carbonyl)amino]phenyl] thiocyanate |
| SMILES | Cc1cc(C(=O)Nc2ccc(SC#N)cc2)c(C)o1 |
| InChI | InChI=1S/C14H12N2O2S/c1-9-7-13(10(2)18-9)14(17)16-11-3-5-12(6-4-11)19-8-15/h3-7H,1-2H3,(H,16,17) |
| InChIKey | KAOSXXLCKCDHMK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|