C14H11ClN2O2 — CID 60628705
N-(5-chloro-2-cyanophenyl)-2,5-dimethylfuran-3-carboxamide (PubChem CID 60628705) has the molecular formula C14H11ClN2O2 and a molecular weight of 274.71 g/mol. Its IUPAC name is N-(5-chloro-2-cyanophenyl)-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-(5-chloro-2-cyanophenyl)-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 60628705 |
| Molecular Formula | C14H11ClN2O2 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | N-(5-chloro-2-cyanophenyl)-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cc(Cl)ccc2C#N)c(C)o1 |
| InChI | InChI=1S/C14H11ClN2O2/c1-8-5-12(9(2)19-8)14(18)17-13-6-11(15)4-3-10(13)7-16/h3-6H,1-2H3,(H,17,18) |
| InChIKey | JIZQVLWPVKSDPI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |