C16H15ClN2O2 — CID 81269162
N-[2-(3-aminoprop-1-ynyl)-5-chlorophenyl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 81269162) has the molecular formula C16H15ClN2O2 and a molecular weight of 302.76 g/mol. Its IUPAC name is N-[2-(3-aminoprop-1-ynyl)-5-chlorophenyl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[2-(3-aminoprop-1-ynyl)-5-chlorophenyl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 81269162 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-[2-(3-aminoprop-1-ynyl)-5-chlorophenyl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cc(Cl)ccc2C#CCN)c(C)o1 |
| InChI | InChI=1S/C16H15ClN2O2/c1-10-8-14(11(2)21-10)16(20)19-15-9-13(17)6-5-12(15)4-3-7-18/h5-6,8-9H,7,18H2,1-2H3,(H,19,20) |
| InChIKey | OSGHXEHPIMVWOD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|