C14H9Cl2NO3 — CID 81263366
5-chloro-N-[5-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]furan-2-carboxamide (PubChem CID 81263366) has the molecular formula C14H9Cl2NO3 and a molecular weight of 310.14 g/mol. Its IUPAC name is 5-chloro-N-[5-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-chloro-N-[5-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 81263366 |
| Molecular Formula | C14H9Cl2NO3 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 5-chloro-N-[5-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1C#CCO)c1ccc(Cl)o1 |
| InChI | InChI=1S/C14H9Cl2NO3/c15-10-4-3-9(2-1-7-18)11(8-10)17-14(19)12-5-6-13(16)20-12/h3-6,8,18H,7H2,(H,17,19) |
| InChIKey | KHYSXHDAJJZHNS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|