C14H9ClFNO3 — CID 104780484
5-chloro-N-[4-fluoro-3-(3-hydroxyprop-1-ynyl)phenyl]furan-2-carboxamide (PubChem CID 104780484) has the molecular formula C14H9ClFNO3 and a molecular weight of 293.68 g/mol. Its IUPAC name is 5-chloro-N-[4-fluoro-3-(3-hydroxyprop-1-ynyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-chloro-N-[4-fluoro-3-(3-hydroxyprop-1-ynyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 104780484 |
| Molecular Formula | C14H9ClFNO3 |
| Molecular Weight | 293.68 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 5-chloro-N-[4-fluoro-3-(3-hydroxyprop-1-ynyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(C#CCO)c1)c1ccc(Cl)o1 |
| InChI | InChI=1S/C14H9ClFNO3/c15-13-6-5-12(20-13)14(19)17-10-3-4-11(16)9(8-10)2-1-7-18/h3-6,8,18H,7H2,(H,17,19) |
| InChIKey | UAVCFCGVQBUSOJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.68 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|