C15H14FN3O2 — CID 102802094
N-[4-fluoro-3-(3-hydroxyprop-1-ynyl)phenyl]-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 102802094) has the molecular formula C15H14FN3O2 and a molecular weight of 287.29 g/mol. Its IUPAC name is N-[4-fluoro-3-(3-hydroxyprop-1-ynyl)phenyl]-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | N-[4-fluoro-3-(3-hydroxyprop-1-ynyl)phenyl]-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 102802094 |
| Molecular Formula | C15H14FN3O2 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-[4-fluoro-3-(3-hydroxyprop-1-ynyl)phenyl]-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)cc1C(=O)Nc1ccc(F)c(C#CCO)c1 |
| InChI | InChI=1S/C15H14FN3O2/c1-10-13(9-19(2)18-10)15(21)17-12-5-6-14(16)11(8-12)4-3-7-20/h5-6,8-9,20H,7H2,1-2H3,(H,17,21) |
| InChIKey | PHMYZGQXLURGPW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|