C11H11FN4O — CID 103789989
N-(6-fluoro-3-pyridinyl)-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 103789989) has the molecular formula C11H11FN4O and a molecular weight of 234.23 g/mol. Its IUPAC name is N-(6-fluoro-3-pyridinyl)-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | N-(6-fluoro-3-pyridinyl)-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 103789989 |
| Molecular Formula | C11H11FN4O |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | N-(6-fluoro-3-pyridinyl)-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)cc1C(=O)Nc1ccc(F)nc1 |
| InChI | InChI=1S/C11H11FN4O/c1-7-9(6-16(2)15-7)11(17)14-8-3-4-10(12)13-5-8/h3-6H,1-2H3,(H,14,17) |
| InChIKey | MQSYLCFGGWVLCU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|