C16H12ClNO3 — CID 81269110
N-[5-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]-4-hydroxybenzamide (PubChem CID 81269110) has the molecular formula C16H12ClNO3 and a molecular weight of 301.73 g/mol. Its IUPAC name is N-[5-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]-4-hydroxybenzamide.
| Compound Name | N-[5-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 81269110 |
| Molecular Formula | C16H12ClNO3 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-[5-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]-4-hydroxybenzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1C#CCO)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H12ClNO3/c17-13-6-3-11(2-1-9-19)15(10-13)18-16(21)12-4-7-14(20)8-5-12/h3-8,10,19-20H,9H2,(H,18,21) |
| InChIKey | HOIRDAWBRKMNGE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|