C14H10Cl2N2OS — CID 81279965
N-[2-(3-aminoprop-1-ynyl)-5-chlorophenyl]-5-chlorothiophene-2-carboxamide (PubChem CID 81279965) has the molecular formula C14H10Cl2N2OS and a molecular weight of 325.22 g/mol. Its IUPAC name is N-[2-(3-aminoprop-1-ynyl)-5-chlorophenyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[2-(3-aminoprop-1-ynyl)-5-chlorophenyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 81279965 |
| Molecular Formula | C14H10Cl2N2OS |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | N-[2-(3-aminoprop-1-ynyl)-5-chlorophenyl]-5-chlorothiophene-2-carboxamide |
| SMILES | NCC#Cc1ccc(Cl)cc1NC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H10Cl2N2OS/c15-10-4-3-9(2-1-7-17)11(8-10)18-14(19)12-5-6-13(16)20-12/h3-6,8H,7,17H2,(H,18,19) |
| InChIKey | NYNSGUZHTLFCBR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|