C16H15ClN2OS — CID 79977293
5-(3-aminoprop-1-ynyl)-N-(4-chloro-2-methylphenyl)-4-methylthiophene-2-carboxamide (PubChem CID 79977293) has the molecular formula C16H15ClN2OS and a molecular weight of 318.83 g/mol. Its IUPAC name is 5-(3-aminoprop-1-ynyl)-N-(4-chloro-2-methylphenyl)-4-methylthiophene-2-carboxamide.
| Compound Name | 5-(3-aminoprop-1-ynyl)-N-(4-chloro-2-methylphenyl)-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79977293 |
| Molecular Formula | C16H15ClN2OS |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 5-(3-aminoprop-1-ynyl)-N-(4-chloro-2-methylphenyl)-4-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)c1cc(C)c(C#CCN)s1 |
| InChI | InChI=1S/C16H15ClN2OS/c1-10-8-12(17)5-6-13(10)19-16(20)15-9-11(2)14(21-15)4-3-7-18/h5-6,8-9H,7,18H2,1-2H3,(H,19,20) |
| InChIKey | ZXCXMDYPPYXUGP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|