C16H14ClN3O — CID 107523760
3-(3-aminoprop-1-ynyl)-N-(4-chloro-2-methylphenyl)pyridine-2-carboxamide (PubChem CID 107523760) has the molecular formula C16H14ClN3O and a molecular weight of 299.76 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-(4-chloro-2-methylphenyl)pyridine-2-carboxamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-(4-chloro-2-methylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107523760 |
| Molecular Formula | C16H14ClN3O |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-(4-chloro-2-methylphenyl)pyridine-2-carboxamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)c1ncccc1C#CCN |
| InChI | InChI=1S/C16H14ClN3O/c1-11-10-13(17)6-7-14(11)20-16(21)15-12(4-2-8-18)5-3-9-19-15/h3,5-7,9-10H,8,18H2,1H3,(H,20,21) |
| InChIKey | PLTNXSFWRQUVOF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|