C15H11Cl2N3O — CID 107523498
3-(3-aminoprop-1-ynyl)-N-(3,5-dichlorophenyl)pyridine-2-carboxamide (PubChem CID 107523498) has the molecular formula C15H11Cl2N3O and a molecular weight of 320.18 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-(3,5-dichlorophenyl)pyridine-2-carboxamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-(3,5-dichlorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107523498 |
| Molecular Formula | C15H11Cl2N3O |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-(3,5-dichlorophenyl)pyridine-2-carboxamide |
| SMILES | NCC#Cc1cccnc1C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H11Cl2N3O/c16-11-7-12(17)9-13(8-11)20-15(21)14-10(3-1-5-18)4-2-6-19-14/h2,4,6-9H,5,18H2,(H,20,21) |
| InChIKey | MIWFHPIHBUTPGE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|