C13H15N3O3 — CID 107523903
methyl 3-[[3-(3-aminoprop-1-ynyl)pyridine-2-carbonyl]amino]propanoate (PubChem CID 107523903) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is methyl 3-[[3-(3-aminoprop-1-ynyl)pyridine-2-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[3-(3-aminoprop-1-ynyl)pyridine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 107523903 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | methyl 3-[[3-(3-aminoprop-1-ynyl)pyridine-2-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1ncccc1C#CCN |
| InChI | InChI=1S/C13H15N3O3/c1-19-11(17)6-9-16-13(18)12-10(4-2-7-14)5-3-8-15-12/h3,5,8H,6-7,9,14H2,1H3,(H,16,18) |
| InChIKey | BKBISIDIDRIJIX-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|