C14H16N6O — CID 107524399
3-(3-aminoprop-1-ynyl)-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyridine-2-carboxamide (PubChem CID 107524399) has the molecular formula C14H16N6O and a molecular weight of 284.32 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyridine-2-carboxamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107524399 |
| Molecular Formula | C14H16N6O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyridine-2-carboxamide |
| SMILES | Cn1cnnc1CCNC(=O)c1ncccc1C#CCN |
| InChI | InChI=1S/C14H16N6O/c1-20-10-18-19-12(20)6-9-17-14(21)13-11(4-2-7-15)5-3-8-16-13/h3,5,8,10H,6-7,9,15H2,1H3,(H,17,21) |
| InChIKey | IFTJYJKRNKJPOP-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|