C14H19N3O2 — CID 107524482
3-(3-aminoprop-1-ynyl)-N-(1-methoxybutan-2-yl)pyridine-2-carboxamide (PubChem CID 107524482) has the molecular formula C14H19N3O2 and a molecular weight of 261.33 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-(1-methoxybutan-2-yl)pyridine-2-carboxamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-(1-methoxybutan-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107524482 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-(1-methoxybutan-2-yl)pyridine-2-carboxamide |
| SMILES | CCC(COC)NC(=O)c1ncccc1C#CCN |
| InChI | InChI=1S/C14H19N3O2/c1-3-12(10-19-2)17-14(18)13-11(6-4-8-15)7-5-9-16-13/h5,7,9,12H,3,8,10,15H2,1-2H3,(H,17,18) |
| InChIKey | BZFLXPKAPFKBMB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|