C16H21N3O — CID 107524452
3-(3-aminoprop-1-ynyl)-N-(1-cyclopropylbutan-2-yl)pyridine-2-carboxamide (PubChem CID 107524452) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-(1-cyclopropylbutan-2-yl)pyridine-2-carboxamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-(1-cyclopropylbutan-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107524452 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-(1-cyclopropylbutan-2-yl)pyridine-2-carboxamide |
| SMILES | CCC(CC1CC1)NC(=O)c1ncccc1C#CCN |
| InChI | InChI=1S/C16H21N3O/c1-2-14(11-12-7-8-12)19-16(20)15-13(5-3-9-17)6-4-10-18-15/h4,6,10,12,14H,2,7-9,11,17H2,1H3,(H,19,20) |
| InChIKey | XOIRTQWJUWVUOZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|