C18H18O8 — CID 91099548
ethyl 4-[3-(4-ethoxy-3,4-dioxobutanoyl)phenyl]-2,4-dioxobutanoate (PubChem CID 91099548) has the molecular formula C18H18O8 and a molecular weight of 362.33 g/mol. Its IUPAC name is ethyl 4-[3-(4-ethoxy-3,4-dioxobutanoyl)phenyl]-2,4-dioxobutanoate.
| Compound Name | ethyl 4-[3-(4-ethoxy-3,4-dioxobutanoyl)phenyl]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 91099548 |
| Molecular Formula | C18H18O8 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | ethyl 4-[3-(4-ethoxy-3,4-dioxobutanoyl)phenyl]-2,4-dioxobutanoate |
| SMILES | CCOC(=O)C(=O)CC(=O)c1cccc(C(=O)CC(=O)C(=O)OCC)c1 |
| InChI | InChI=1S/C18H18O8/c1-3-25-17(23)15(21)9-13(19)11-6-5-7-12(8-11)14(20)10-16(22)18(24)26-4-2/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | MZEHFQRJHNAPQH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|