C14H15ClO4 — CID 118069401
tert-butyl 4-(3-chlorophenyl)-2,4-dioxobutanoate (PubChem CID 118069401) has the molecular formula C14H15ClO4 and a molecular weight of 282.72 g/mol. Its IUPAC name is tert-butyl 4-(3-chlorophenyl)-2,4-dioxobutanoate.
| Compound Name | tert-butyl 4-(3-chlorophenyl)-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 118069401 |
| Molecular Formula | C14H15ClO4 |
| Molecular Weight | 282.72 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | tert-butyl 4-(3-chlorophenyl)-2,4-dioxobutanoate |
| SMILES | CC(C)(C)OC(=O)C(=O)CC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H15ClO4/c1-14(2,3)19-13(18)12(17)8-11(16)9-5-4-6-10(15)7-9/h4-7H,8H2,1-3H3 |
| InChIKey | VOMMWTZYQCTPON-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.72 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|