C17H22ClNO5S — CID 7072280
ethyl (2R)-3-(3-chlorobenzoyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 7072280) has the molecular formula C17H22ClNO5S and a molecular weight of 387.89 g/mol. Its IUPAC name is ethyl (2R)-3-(3-chlorobenzoyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | ethyl (2R)-3-(3-chlorobenzoyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 7072280 |
| Molecular Formula | C17H22ClNO5S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | ethyl (2R)-3-(3-chlorobenzoyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCOC(=O)[C@H](CSC(=O)c1cccc(Cl)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H22ClNO5S/c1-5-23-14(20)13(19-16(22)24-17(2,3)4)10-25-15(21)11-7-6-8-12(18)9-11/h6-9,13H,5,10H2,1-4H3,(H,19,22)/t13-/m0/s1 |
| InChIKey | DCCGHTQOVPPDKL-ZDUSSCGKSA-N |
| XLogP | 3.67 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|