C31H31N3O3 — CID 20708240
N-[3-[(3-carbamimidoylphenyl)methyl]-4-hydroxy-1-phenylbutan-2-yl]-4-(3-hydroxyphenyl)benzamide (PubChem CID 20708240) has the molecular formula C31H31N3O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is N-[3-[(3-carbamimidoylphenyl)methyl]-4-hydroxy-1-phenylbutan-2-yl]-4-(3-hydroxyphenyl)benzamide.
| Compound Name | N-[3-[(3-carbamimidoylphenyl)methyl]-4-hydroxy-1-phenylbutan-2-yl]-4-(3-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 20708240 |
| Molecular Formula | C31H31N3O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | N-[3-[(3-carbamimidoylphenyl)methyl]-4-hydroxy-1-phenylbutan-2-yl]-4-(3-hydroxyphenyl)benzamide |
| SMILES | [H]/N=C(\N)c1cccc(CC(CO)C(Cc2ccccc2)NC(=O)c2ccc(-c3cccc(O)c3)cc2)c1 |
| InChI | InChI=1S/C31H31N3O3/c32-30(33)26-10-4-8-22(16-26)17-27(20-35)29(18-21-6-2-1-3-7-21)34-31(37)24-14-12-23(13-15-24)25-9-5-11-28(36)19-25/h1-16,19,27,29,35-36H,17-18,20H2,(H3,32,33)(H,34,37) |
| InChIKey | OXNJTTYOCUHODK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|