C15H22ClN3O4 — CID 22173574
3-(3-carbamimidoylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;hydrochloride (PubChem CID 22173574) has the molecular formula C15H22ClN3O4 and a molecular weight of 343.81 g/mol. Its IUPAC name is 3-(3-carbamimidoylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;hydrochloride.
| Compound Name | 3-(3-carbamimidoylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 22173574 |
| Molecular Formula | C15H22ClN3O4 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 3-(3-carbamimidoylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cccc(CC(NC(=O)OC(C)(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C15H21N3O4.ClH/c1-15(2,3)22-14(21)18-11(13(19)20)8-9-5-4-6-10(7-9)12(16)17;/h4-7,11H,8H2,1-3H3,(H3,16,17)(H,18,21)(H,19,20);1H |
| InChIKey | UZEFGCDFDWAWHN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|