C25H33N5O5 — CID 10163045
tert-butyl N-[(2R)-1-[[2-[(3-carbamimidoylphenyl)methylamino]-2-oxoethyl]amino]-1-oxo-3-phenylmethoxypropan-2-yl]carbamate (PubChem CID 10163045) has the molecular formula C25H33N5O5 and a molecular weight of 483.57 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[[2-[(3-carbamimidoylphenyl)methylamino]-2-oxoethyl]amino]-1-oxo-3-phenylmethoxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[[2-[(3-carbamimidoylphenyl)methylamino]-2-oxoethyl]amino]-1-oxo-3-phenylmethoxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10163045 |
| Molecular Formula | C25H33N5O5 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | tert-butyl N-[(2R)-1-[[2-[(3-carbamimidoylphenyl)methylamino]-2-oxoethyl]amino]-1-oxo-3-phenylmethoxypropan-2-yl]carbamate |
| SMILES | [H]/N=C(\N)c1cccc(CNC(=O)CNC(=O)[C@@H](COCc2ccccc2)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C25H33N5O5/c1-25(2,3)35-24(33)30-20(16-34-15-17-8-5-4-6-9-17)23(32)29-14-21(31)28-13-18-10-7-11-19(12-18)22(26)27/h4-12,20H,13-16H2,1-3H3,(H3,26,27)(H,28,31)(H,29,32)(H,30,33)/t20-/m1/s1 |
| InChIKey | MVPKMPWWIZQVRS-HXUWFJFHSA-N |
| XLogP | 1.81 |
| TPSA | 155.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|