About benzenecarboximidamide;2-bromo-1-(4-methylsulfonylphenyl)ethanone
benzenecarboximidamide;2-bromo-1-(4-methylsulfonylphenyl)ethanone (PubChem CID 160887992) has the molecular formula C16H17BrN2O3S
and a molecular weight of 397.29 g/mol. Its IUPAC name is benzenecarboximidamide;2-bromo-1-(4-methylsulfonylphenyl)ethanone.
Molecular Properties
| Compound Name | benzenecarboximidamide;2-bromo-1-(4-methylsulfonylphenyl)ethanone |
| PubChem CID | 160887992 |
| Molecular Formula | C16H17BrN2O3S |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | benzenecarboximidamide;2-bromo-1-(4-methylsulfonylphenyl)ethanone |
| SMILES | CS(=O)(=O)c1ccc(C(=O)CBr)cc1.[H]/N=C(\N)c1ccccc1 |
| InChI | InChI=1S/C9H9BrO3S.C7H8N2/c1-14(12,13)8-4-2-7(3-5-8)9(11)6-10;8-7(9)6-4-2-1-3-5-6/h2-5H,6H2,1H3;1-5H,(H3,8,9) |
| InChIKey | SNWVUDOSWLSNRR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze benzenecarboximidamide;2-bromo-1-(4-methylsulfonylphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarboximidamide;2-bromo-1-(4-methylsulfonylphenyl)ethanone?
The IUPAC name of benzenecarboximidamide;2-bromo-1-(4-methylsulfonylphenyl)ethanone (CID 160887992) is benzenecarboximidamide;2-bromo-1-(4-methylsulfonylphenyl)ethanone.
What is the SMILES notation for benzenecarboximidamide;2-bromo-1-(4-methylsulfonylphenyl)ethanone?
The canonical SMILES for benzenecarboximidamide;2-bromo-1-(4-methylsulfonylphenyl)ethanone is CS(=O)(=O)c1ccc(C(=O)CBr)cc1.[H]/N=C(\N)c1ccccc1.
What is the InChIKey of benzenecarboximidamide;2-bromo-1-(4-methylsulfonylphenyl)ethanone?
The InChIKey is SNWVUDOSWLSNRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO3S.C7H8N2/c1-14(12,13)8-4-2-7(3-5-8)9(11)6-10;8-7(9)6-4-2-1-3-5-6/h2-5H,6H2,1H3;1-5H,(H3,8,9).
What are the key properties of benzenecarboximidamide;2-bromo-1-(4-methylsulfonylphenyl)ethanone?
benzenecarboximidamide;2-bromo-1-(4-methylsulfonylphenyl)ethanone has a molecular weight of 397.29 g/mol, XLogP of 2.64, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarboximidamide;2-bromo-1-(4-methylsulfonylphenyl)ethanone is sourced from PubChem (CID 160887992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).