About 2-bromo-1-phenylethanone;hydrochloride
2-bromo-1-phenylethanone;hydrochloride (PubChem CID 172844250) has the molecular formula C8H8BrClO
and a molecular weight of 235.51 g/mol. Its IUPAC name is 2-bromo-1-phenylethanone;hydrochloride.
Molecular Properties
| Compound Name | 2-bromo-1-phenylethanone;hydrochloride |
| PubChem CID | 172844250 |
| Molecular Formula | C8H8BrClO |
| Molecular Weight | 235.51 g/mol |
| Exact Mass | 233.94 |
| IUPAC Name | 2-bromo-1-phenylethanone;hydrochloride |
| SMILES | Cl.O=C(CBr)c1ccccc1 |
| InChI | InChI=1S/C8H7BrO.ClH/c9-6-8(10)7-4-2-1-3-5-7;/h1-5H,6H2;1H |
| InChIKey | XWHFBUBBVDXCRM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-phenylethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-phenylethanone;hydrochloride?
The IUPAC name of 2-bromo-1-phenylethanone;hydrochloride (CID 172844250) is 2-bromo-1-phenylethanone;hydrochloride.
What is the SMILES notation for 2-bromo-1-phenylethanone;hydrochloride?
The canonical SMILES for 2-bromo-1-phenylethanone;hydrochloride is Cl.O=C(CBr)c1ccccc1.
What is the InChIKey of 2-bromo-1-phenylethanone;hydrochloride?
The InChIKey is XWHFBUBBVDXCRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrO.ClH/c9-6-8(10)7-4-2-1-3-5-7;/h1-5H,6H2;1H.
What are the key properties of 2-bromo-1-phenylethanone;hydrochloride?
2-bromo-1-phenylethanone;hydrochloride has a molecular weight of 235.51 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-phenylethanone;hydrochloride is sourced from PubChem (CID 172844250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).