C12H16BrNO6 — CID 174434455
2-bromo-1-phenylethanone;2-(hydroxymethyl)-2-nitropropane-1,3-diol (PubChem CID 174434455) has the molecular formula C12H16BrNO6 and a molecular weight of 350.17 g/mol. Its IUPAC name is 2-bromo-1-phenylethanone;2-(hydroxymethyl)-2-nitropropane-1,3-diol.
| Compound Name | 2-bromo-1-phenylethanone;2-(hydroxymethyl)-2-nitropropane-1,3-diol |
|---|---|
| PubChem CID | 174434455 |
| Molecular Formula | C12H16BrNO6 |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 2-bromo-1-phenylethanone;2-(hydroxymethyl)-2-nitropropane-1,3-diol |
| SMILES | O=C(CBr)c1ccccc1.O=[N+]([O-])C(CO)(CO)CO |
| InChI | InChI=1S/C8H7BrO.C4H9NO5/c9-6-8(10)7-4-2-1-3-5-7;6-1-4(2-7,3-8)5(9)10/h1-5H,6H2;6-8H,1-3H2 |
| InChIKey | NRMQTGZISXUTOS-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|