C16H19NO5 — CID 161424002
1,1'-biphenyl;2-(hydroxymethyl)-2-nitropropane-1,3-diol (PubChem CID 161424002) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is 1,1'-biphenyl;2-(hydroxymethyl)-2-nitropropane-1,3-diol.
| Compound Name | 1,1'-biphenyl;2-(hydroxymethyl)-2-nitropropane-1,3-diol |
|---|---|
| PubChem CID | 161424002 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1,1'-biphenyl;2-(hydroxymethyl)-2-nitropropane-1,3-diol |
| SMILES | O=[N+]([O-])C(CO)(CO)CO.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C4H9NO5/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;6-1-4(2-7,3-8)5(9)10/h1-10H;6-8H,1-3H2 |
| InChIKey | VXCOTTBWIOYWHL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|