C6H16N2O5 — CID 174743250
ethanamine;2-(hydroxymethyl)-2-nitropropane-1,3-diol (PubChem CID 174743250) has the molecular formula C6H16N2O5 and a molecular weight of 196.20 g/mol. Its IUPAC name is ethanamine;2-(hydroxymethyl)-2-nitropropane-1,3-diol.
| Compound Name | ethanamine;2-(hydroxymethyl)-2-nitropropane-1,3-diol |
|---|---|
| PubChem CID | 174743250 |
| Molecular Formula | C6H16N2O5 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | ethanamine;2-(hydroxymethyl)-2-nitropropane-1,3-diol |
| SMILES | CCN.O=[N+]([O-])C(CO)(CO)CO |
| InChI | InChI=1S/C4H9NO5.C2H7N/c6-1-4(2-7,3-8)5(9)10;1-2-3/h6-8H,1-3H2;2-3H2,1H3 |
| InChIKey | YQNWYYFFUQXGBT-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|