About 2-(hydroxymethyl)-2-nitropropane-1,3-diol;pentanedial
2-(hydroxymethyl)-2-nitropropane-1,3-diol;pentanedial (PubChem CID 87467041) has the molecular formula C9H17NO7
and a molecular weight of 251.23 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-nitropropane-1,3-diol;pentanedial.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-2-nitropropane-1,3-diol;pentanedial |
| PubChem CID | 87467041 |
| Molecular Formula | C9H17NO7 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 2-(hydroxymethyl)-2-nitropropane-1,3-diol;pentanedial |
| SMILES | O=CCCCC=O.O=[N+]([O-])C(CO)(CO)CO |
| InChI | InChI=1S/C5H8O2.C4H9NO5/c6-4-2-1-3-5-7;6-1-4(2-7,3-8)5(9)10/h4-5H,1-3H2;6-8H,1-3H2 |
| InChIKey | MMMKQCQDUOKOLU-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 137.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)-2-nitropropane-1,3-diol;pentanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-2-nitropropane-1,3-diol;pentanedial?
The IUPAC name of 2-(hydroxymethyl)-2-nitropropane-1,3-diol;pentanedial (CID 87467041) is 2-(hydroxymethyl)-2-nitropropane-1,3-diol;pentanedial.
What is the SMILES notation for 2-(hydroxymethyl)-2-nitropropane-1,3-diol;pentanedial?
The canonical SMILES for 2-(hydroxymethyl)-2-nitropropane-1,3-diol;pentanedial is O=CCCCC=O.O=[N+]([O-])C(CO)(CO)CO.
What is the InChIKey of 2-(hydroxymethyl)-2-nitropropane-1,3-diol;pentanedial?
The InChIKey is MMMKQCQDUOKOLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C4H9NO5/c6-4-2-1-3-5-7;6-1-4(2-7,3-8)5(9)10/h4-5H,1-3H2;6-8H,1-3H2.
What are the key properties of 2-(hydroxymethyl)-2-nitropropane-1,3-diol;pentanedial?
2-(hydroxymethyl)-2-nitropropane-1,3-diol;pentanedial has a molecular weight of 251.23 g/mol, XLogP of -1.47, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-2-nitropropane-1,3-diol;pentanedial is sourced from PubChem (CID 87467041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).