pentanedial;periodic acid

C5H9IO6 — CID 87536343

IUPACpentanedial;periodic acid
SMILESO=CCCCC=O.[O-][I+3]([O-])([O-])O
InChIInChI=1S/C5H8O2.HIO4/c6-4-2-1-3-5-7;2-1(3,4)5/h4-5H,1-3H2;2H
InChIKeySGFCPDZORDUQRX-UHFFFAOYSA-N
MW292.02 g/mol
LogP-6.57
Rot. Bonds4

About pentanedial;periodic acid

pentanedial;periodic acid (PubChem CID 87536343) has the molecular formula C5H9IO6 and a molecular weight of 292.02 g/mol. Its IUPAC name is pentanedial;periodic acid.

Molecular Properties

Compound Namepentanedial;periodic acid
PubChem CID87536343
Molecular FormulaC5H9IO6
Molecular Weight292.02 g/mol
Exact Mass291.94
IUPAC Namepentanedial;periodic acid
SMILESO=CCCCC=O.[O-][I+3]([O-])([O-])O
InChIInChI=1S/C5H8O2.HIO4/c6-4-2-1-3-5-7;2-1(3,4)5/h4-5H,1-3H2;2H
InChIKeySGFCPDZORDUQRX-UHFFFAOYSA-N
XLogP-6.57
TPSA123.55 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.02
LogP ≤ 5-6.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze pentanedial;periodic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pentanedial;periodic acid?
The IUPAC name of pentanedial;periodic acid (CID 87536343) is pentanedial;periodic acid.
What is the SMILES notation for pentanedial;periodic acid?
The canonical SMILES for pentanedial;periodic acid is O=CCCCC=O.[O-][I+3]([O-])([O-])O.
What is the InChIKey of pentanedial;periodic acid?
The InChIKey is SGFCPDZORDUQRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.HIO4/c6-4-2-1-3-5-7;2-1(3,4)5/h4-5H,1-3H2;2H.
What are the key properties of pentanedial;periodic acid?
pentanedial;periodic acid has a molecular weight of 292.02 g/mol, XLogP of -6.57, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pentanedial;periodic acid is sourced from PubChem (CID 87536343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).