About pentanedial;periodic acid
pentanedial;periodic acid (PubChem CID 87536343) has the molecular formula C5H9IO6
and a molecular weight of 292.02 g/mol. Its IUPAC name is pentanedial;periodic acid.
Molecular Properties
| Compound Name | pentanedial;periodic acid |
| PubChem CID | 87536343 |
| Molecular Formula | C5H9IO6 |
| Molecular Weight | 292.02 g/mol |
| Exact Mass | 291.94 |
| IUPAC Name | pentanedial;periodic acid |
| SMILES | O=CCCCC=O.[O-][I+3]([O-])([O-])O |
| InChI | InChI=1S/C5H8O2.HIO4/c6-4-2-1-3-5-7;2-1(3,4)5/h4-5H,1-3H2;2H |
| InChIKey | SGFCPDZORDUQRX-UHFFFAOYSA-N |
| XLogP | -6.57 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.02 |
| LogP ≤ 5 | -6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze pentanedial;periodic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanedial;periodic acid?
The IUPAC name of pentanedial;periodic acid (CID 87536343) is pentanedial;periodic acid.
What is the SMILES notation for pentanedial;periodic acid?
The canonical SMILES for pentanedial;periodic acid is O=CCCCC=O.[O-][I+3]([O-])([O-])O.
What is the InChIKey of pentanedial;periodic acid?
The InChIKey is SGFCPDZORDUQRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.HIO4/c6-4-2-1-3-5-7;2-1(3,4)5/h4-5H,1-3H2;2H.
What are the key properties of pentanedial;periodic acid?
pentanedial;periodic acid has a molecular weight of 292.02 g/mol, XLogP of -6.57, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pentanedial;periodic acid is sourced from PubChem (CID 87536343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).