About sodium;hydrogen sulfate;pentanedial
sodium;hydrogen sulfate;pentanedial (PubChem CID 23672789) has the molecular formula C5H9NaO6S
and a molecular weight of 220.18 g/mol. Its IUPAC name is sodium;hydrogen sulfate;pentanedial.
Molecular Properties
| Compound Name | sodium;hydrogen sulfate;pentanedial |
| PubChem CID | 23672789 |
| Molecular Formula | C5H9NaO6S |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | sodium;hydrogen sulfate;pentanedial |
| SMILES | O=CCCCC=O.O=S(=O)([O-])O.[Na+] |
| InChI | InChI=1S/C5H8O2.Na.H2O4S/c6-4-2-1-3-5-7;;1-5(2,3)4/h4-5H,1-3H2;;(H2,1,2,3,4)/q;+1;/p-1 |
| InChIKey | YXANJHQJDJLGLP-UHFFFAOYSA-M |
| XLogP | -3.44 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydrogen sulfate;pentanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydrogen sulfate;pentanedial?
The IUPAC name of sodium;hydrogen sulfate;pentanedial (CID 23672789) is sodium;hydrogen sulfate;pentanedial.
What is the SMILES notation for sodium;hydrogen sulfate;pentanedial?
The canonical SMILES for sodium;hydrogen sulfate;pentanedial is O=CCCCC=O.O=S(=O)([O-])O.[Na+].
What is the InChIKey of sodium;hydrogen sulfate;pentanedial?
The InChIKey is YXANJHQJDJLGLP-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8O2.Na.H2O4S/c6-4-2-1-3-5-7;;1-5(2,3)4/h4-5H,1-3H2;;(H2,1,2,3,4)/q;+1;/p-1.
What are the key properties of sodium;hydrogen sulfate;pentanedial?
sodium;hydrogen sulfate;pentanedial has a molecular weight of 220.18 g/mol, XLogP of -3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydrogen sulfate;pentanedial is sourced from PubChem (CID 23672789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).