About 2-ethyl-2-nitrooctan-1-ol;nitric acid
2-ethyl-2-nitrooctan-1-ol;nitric acid (PubChem CID 88722993) has the molecular formula C10H22N2O6
and a molecular weight of 266.29 g/mol. Its IUPAC name is 2-ethyl-2-nitrooctan-1-ol;nitric acid.
Molecular Properties
| Compound Name | 2-ethyl-2-nitrooctan-1-ol;nitric acid |
| PubChem CID | 88722993 |
| Molecular Formula | C10H22N2O6 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-ethyl-2-nitrooctan-1-ol;nitric acid |
| SMILES | CCCCCCC(CC)(CO)[N+](=O)[O-].O=[N+]([O-])O |
| InChI | InChI=1S/C10H21NO3.HNO3/c1-3-5-6-7-8-10(4-2,9-12)11(13)14;2-1(3)4/h12H,3-9H2,1-2H3;(H,2,3,4) |
| InChIKey | FAVMNCCFTHLQTF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-2-nitrooctan-1-ol;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-nitrooctan-1-ol;nitric acid?
The IUPAC name of 2-ethyl-2-nitrooctan-1-ol;nitric acid (CID 88722993) is 2-ethyl-2-nitrooctan-1-ol;nitric acid.
What is the SMILES notation for 2-ethyl-2-nitrooctan-1-ol;nitric acid?
The canonical SMILES for 2-ethyl-2-nitrooctan-1-ol;nitric acid is CCCCCCC(CC)(CO)[N+](=O)[O-].O=[N+]([O-])O.
What is the InChIKey of 2-ethyl-2-nitrooctan-1-ol;nitric acid?
The InChIKey is FAVMNCCFTHLQTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO3.HNO3/c1-3-5-6-7-8-10(4-2,9-12)11(13)14;2-1(3)4/h12H,3-9H2,1-2H3;(H,2,3,4).
What are the key properties of 2-ethyl-2-nitrooctan-1-ol;nitric acid?
2-ethyl-2-nitrooctan-1-ol;nitric acid has a molecular weight of 266.29 g/mol, XLogP of 2.03, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-nitrooctan-1-ol;nitric acid is sourced from PubChem (CID 88722993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).