C14H30N2O7 — CID 87201338
2-hexyl-2-nitropropane-1,3-diol;2-nitropentan-1-ol (PubChem CID 87201338) has the molecular formula C14H30N2O7 and a molecular weight of 338.40 g/mol. Its IUPAC name is 2-hexyl-2-nitropropane-1,3-diol;2-nitropentan-1-ol.
| Compound Name | 2-hexyl-2-nitropropane-1,3-diol;2-nitropentan-1-ol |
|---|---|
| PubChem CID | 87201338 |
| Molecular Formula | C14H30N2O7 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-hexyl-2-nitropropane-1,3-diol;2-nitropentan-1-ol |
| SMILES | CCCC(CO)[N+](=O)[O-].CCCCCCC(CO)(CO)[N+](=O)[O-] |
| InChI | InChI=1S/C9H19NO4.C5H11NO3/c1-2-3-4-5-6-9(7-11,8-12)10(13)14;1-2-3-5(4-7)6(8)9/h11-12H,2-8H2,1H3;5,7H,2-4H2,1H3 |
| InChIKey | UBPSWLZGXQHGGL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 146.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|