C11H27N3O4 — CID 131729996
2-ethyl-2-nitropropane-1,3-diol;hexane-1,6-diamine (PubChem CID 131729996) has the molecular formula C11H27N3O4 and a molecular weight of 265.35 g/mol. Its IUPAC name is 2-ethyl-2-nitropropane-1,3-diol;hexane-1,6-diamine.
| Compound Name | 2-ethyl-2-nitropropane-1,3-diol;hexane-1,6-diamine |
|---|---|
| PubChem CID | 131729996 |
| Molecular Formula | C11H27N3O4 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 2-ethyl-2-nitropropane-1,3-diol;hexane-1,6-diamine |
| SMILES | CCC(CO)(CO)[N+](=O)[O-].NCCCCCCN |
| InChI | InChI=1S/C6H16N2.C5H11NO4/c7-5-3-1-2-4-6-8;1-2-5(3-7,4-8)6(9)10/h1-8H2;7-8H,2-4H2,1H3 |
| InChIKey | MEWNWMGQTQDHKB-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|