C26H53N5O12 — CID 118944208
2-[[6-[[2-hydroperoxy-2-(hydroxymethyl)butyl]-[2-(hydroxymethyl)-2-nitrobutyl]amino]hexyl-[2-(hydroxymethyl)-2-nitrobutyl]amino]methyl]-2-nitrobutan-1-ol (PubChem CID 118944208) has the molecular formula C26H53N5O12 and a molecular weight of 627.73 g/mol. Its IUPAC name is 2-[[6-[[2-hydroperoxy-2-(hydroxymethyl)butyl]-[2-(hydroxymethyl)-2-nitrobutyl]amino]hexyl-[2-(hydroxymethyl)-2-nitrobutyl]amino]methyl]-2-nitrobutan-1-ol.
| Compound Name | 2-[[6-[[2-hydroperoxy-2-(hydroxymethyl)butyl]-[2-(hydroxymethyl)-2-nitrobutyl]amino]hexyl-[2-(hydroxymethyl)-2-nitrobutyl]amino]methyl]-2-nitrobutan-1-ol |
|---|---|
| PubChem CID | 118944208 |
| Molecular Formula | C26H53N5O12 |
| Molecular Weight | 627.73 g/mol |
| Exact Mass | 627.37 |
| IUPAC Name | 2-[[6-[[2-hydroperoxy-2-(hydroxymethyl)butyl]-[2-(hydroxymethyl)-2-nitrobutyl]amino]hexyl-[2-(hydroxymethyl)-2-nitrobutyl]amino]methyl]-2-nitrobutan-1-ol |
| SMILES | CCC(CO)(CN(CCCCCCN(CC(CC)(CO)[N+](=O)[O-])CC(CC)(CO)[N+](=O)[O-])CC(CC)(CO)[N+](=O)[O-])OO |
| InChI | InChI=1S/C26H53N5O12/c1-5-23(19-32,29(36)37)15-27(16-24(6-2,20-33)30(38)39)13-11-9-10-12-14-28(18-26(8-4,22-35)43-42)17-25(7-3,21-34)31(40)41/h32-35,42H,5-22H2,1-4H3 |
| InChIKey | RZAVVHHJUMFIQE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 246.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.73 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|