C7H17NO5Si — CID 174453521
2-(hydroxymethyl)-2-nitropropane-1,3-diol;prop-2-enylsilane (PubChem CID 174453521) has the molecular formula C7H17NO5Si and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-nitropropane-1,3-diol;prop-2-enylsilane.
| Compound Name | 2-(hydroxymethyl)-2-nitropropane-1,3-diol;prop-2-enylsilane |
|---|---|
| PubChem CID | 174453521 |
| Molecular Formula | C7H17NO5Si |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2-(hydroxymethyl)-2-nitropropane-1,3-diol;prop-2-enylsilane |
| SMILES | C=CC[SiH3].O=[N+]([O-])C(CO)(CO)CO |
| InChI | InChI=1S/C4H9NO5.C3H8Si/c6-1-4(2-7,3-8)5(9)10;1-2-3-4/h6-8H,1-3H2;2H,1,3H2,4H3 |
| InChIKey | WIEBQXHBIJMRDU-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|