C6H11NO4 — CID 102249478
2-nitro-2-prop-1-en-2-ylpropane-1,3-diol (PubChem CID 102249478) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is 2-nitro-2-prop-1-en-2-ylpropane-1,3-diol.
| Compound Name | 2-nitro-2-prop-1-en-2-ylpropane-1,3-diol |
|---|---|
| PubChem CID | 102249478 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 2-nitro-2-prop-1-en-2-ylpropane-1,3-diol |
| SMILES | C=C(C)C(CO)(CO)[N+](=O)[O-] |
| InChI | InChI=1S/C6H11NO4/c1-5(2)6(3-8,4-9)7(10)11/h8-9H,1,3-4H2,2H3 |
| InChIKey | PCHXQPMMWSHGPV-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|