C6H10N4O10 — CID 4197212
2,2,5,5-tetranitrohexane-1,6-diol (PubChem CID 4197212) has the molecular formula C6H10N4O10 and a molecular weight of 298.16 g/mol. Its IUPAC name is 2,2,5,5-tetranitrohexane-1,6-diol.
| Compound Name | 2,2,5,5-tetranitrohexane-1,6-diol |
|---|---|
| PubChem CID | 4197212 |
| Molecular Formula | C6H10N4O10 |
| Molecular Weight | 298.16 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2,2,5,5-tetranitrohexane-1,6-diol |
| SMILES | O=[N+]([O-])C(CO)(CCC(CO)([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C6H10N4O10/c11-3-5(7(13)14,8(15)16)1-2-6(4-12,9(17)18)10(19)20/h11-12H,1-4H2 |
| InChIKey | HZRYMASSDDURDC-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 213.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.16 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|