C13H20N8O20 — CID 90774867
3-[4-(3-hydroxy-2,2-dinitropropoxy)-2,2,6,6-tetranitroheptan-4-yl]oxy-2,2-dinitropropan-1-ol (PubChem CID 90774867) has the molecular formula C13H20N8O20 and a molecular weight of 608.34 g/mol. Its IUPAC name is 3-[4-(3-hydroxy-2,2-dinitropropoxy)-2,2,6,6-tetranitroheptan-4-yl]oxy-2,2-dinitropropan-1-ol.
| Compound Name | 3-[4-(3-hydroxy-2,2-dinitropropoxy)-2,2,6,6-tetranitroheptan-4-yl]oxy-2,2-dinitropropan-1-ol |
|---|---|
| PubChem CID | 90774867 |
| Molecular Formula | C13H20N8O20 |
| Molecular Weight | 608.34 g/mol |
| Exact Mass | 608.08 |
| IUPAC Name | 3-[4-(3-hydroxy-2,2-dinitropropoxy)-2,2,6,6-tetranitroheptan-4-yl]oxy-2,2-dinitropropan-1-ol |
| SMILES | CC(CC(CC(C)([N+](=O)[O-])[N+](=O)[O-])(OCC(CO)([N+](=O)[O-])[N+](=O)[O-])OCC(CO)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C13H20N8O20/c1-9(14(24)25,15(26)27)3-13(4-10(2,16(28)29)17(30)31,40-7-11(5-22,18(32)33)19(34)35)41-8-12(6-23,20(36)37)21(38)39/h22-23H,3-8H2,1-2H3 |
| InChIKey | AWCDVXFUXKJMNY-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 404.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.34 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|