C7H12N4O11 — CID 102161092
1-(1,1-dinitroethoxymethoxymethoxy)-2,2-dinitropropane (PubChem CID 102161092) has the molecular formula C7H12N4O11 and a molecular weight of 328.19 g/mol. Its IUPAC name is 1-(1,1-dinitroethoxymethoxymethoxy)-2,2-dinitropropane.
| Compound Name | 1-(1,1-dinitroethoxymethoxymethoxy)-2,2-dinitropropane |
|---|---|
| PubChem CID | 102161092 |
| Molecular Formula | C7H12N4O11 |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 1-(1,1-dinitroethoxymethoxymethoxy)-2,2-dinitropropane |
| SMILES | CC(COCOCOC(C)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C7H12N4O11/c1-6(8(12)13,9(14)15)3-20-4-21-5-22-7(2,10(16)17)11(18)19/h3-5H2,1-2H3 |
| InChIKey | VWOXHTDMZIWZRL-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 200.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|