C4H6N4O7 — CID 5462745
(Z)-N-(1,1-dinitroethoxy)-2-nitroethanimine (PubChem CID 5462745) has the molecular formula C4H6N4O7 and a molecular weight of 222.11 g/mol. Its IUPAC name is (Z)-N-(1,1-dinitroethoxy)-2-nitroethanimine.
| Compound Name | (Z)-N-(1,1-dinitroethoxy)-2-nitroethanimine |
|---|---|
| PubChem CID | 5462745 |
| Molecular Formula | C4H6N4O7 |
| Molecular Weight | 222.11 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | (Z)-N-(1,1-dinitroethoxy)-2-nitroethanimine |
| SMILES | CC(O/N=C\C[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C4H6N4O7/c1-4(7(11)12,8(13)14)15-5-2-3-6(9)10/h2H,3H2,1H3/b5-2- |
| InChIKey | CDGXKKXUKUPRTJ-DJWKRKHSSA-N |
| XLogP | -0.51 |
| TPSA | 151.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.11 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|