About 5,5-dimethyl-1,1-dinitrohex-1-ene
5,5-dimethyl-1,1-dinitrohex-1-ene (PubChem CID 154425295) has the molecular formula C8H14N2O4
and a molecular weight of 202.21 g/mol. Its IUPAC name is 5,5-dimethyl-1,1-dinitrohex-1-ene.
Molecular Properties
| Compound Name | 5,5-dimethyl-1,1-dinitrohex-1-ene |
| PubChem CID | 154425295 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 5,5-dimethyl-1,1-dinitrohex-1-ene |
| SMILES | CC(C)(C)CCC=C([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C8H14N2O4/c1-8(2,3)6-4-5-7(9(11)12)10(13)14/h5H,4,6H2,1-3H3 |
| InChIKey | RZZVUCJOAJFILG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-1,1-dinitrohex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-1,1-dinitrohex-1-ene?
The IUPAC name of 5,5-dimethyl-1,1-dinitrohex-1-ene (CID 154425295) is 5,5-dimethyl-1,1-dinitrohex-1-ene.
What is the SMILES notation for 5,5-dimethyl-1,1-dinitrohex-1-ene?
The canonical SMILES for 5,5-dimethyl-1,1-dinitrohex-1-ene is CC(C)(C)CCC=C([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 5,5-dimethyl-1,1-dinitrohex-1-ene?
The InChIKey is RZZVUCJOAJFILG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O4/c1-8(2,3)6-4-5-7(9(11)12)10(13)14/h5H,4,6H2,1-3H3.
What are the key properties of 5,5-dimethyl-1,1-dinitrohex-1-ene?
5,5-dimethyl-1,1-dinitrohex-1-ene has a molecular weight of 202.21 g/mol, XLogP of 2.21, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-1,1-dinitrohex-1-ene is sourced from PubChem (CID 154425295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).