C6H11N3O4 — CID 175525236
N,N-dimethyl-4,4-dinitrobut-3-en-1-amine (PubChem CID 175525236) has the molecular formula C6H11N3O4 and a molecular weight of 189.17 g/mol. Its IUPAC name is N,N-dimethyl-4,4-dinitrobut-3-en-1-amine.
| Compound Name | N,N-dimethyl-4,4-dinitrobut-3-en-1-amine |
|---|---|
| PubChem CID | 175525236 |
| Molecular Formula | C6H11N3O4 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | N,N-dimethyl-4,4-dinitrobut-3-en-1-amine |
| SMILES | CN(C)CCC=C([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C6H11N3O4/c1-7(2)5-3-4-6(8(10)11)9(12)13/h4H,3,5H2,1-2H3 |
| InChIKey | NNFTVFQJGPEHQG-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|